Home
Products
Apiopaeonoside
| Product Name | Apiopaeonoside |
| Price: | $321 / 20mg |
| Catalog No.: | CN03764 |
| CAS No.: | 100291-86-9 |
| Molecular Formula: | C20H28O12 |
| Molecular Weight: | 460.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Paeonia lactiflora Pall. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1ccc(c(c1)OC1OC(COC2OCC(C2O)(O)CO)C(C(C1O)O)O)C(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Apiopaeonoside is a natural product isolated from the root of Paeonia suffruticosa[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 765.9±60.0 °C at 760 mmHg |
| Flash Point | 267.0±26.4 °C |
| Exact Mass | 460.158081 |
| PSA | 184.60000 |
| LogP | -0.22 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Storage condition | 2-8℃ |