Home
Products
Ganoderenic acid D
| Product Name | Ganoderenic acid D |
| Price: | $234 / 10mg |
| Catalog No.: | CN07788 |
| CAS No.: | 100665-43-8 |
| Molecular Formula: | C30H40O7 |
| Molecular Weight: | 512.64 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(C(=O)O)C)/C=C([C@H]1CC(=O)[C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)CC2[C@]1(C)CCC(=O)C2(C)C)C)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderenic acid D is a triterpene identified from the effective compounds of Ganoderma lucidum extract (GLE). Ganoderenic acid D inhibits the proliferation of cancer cells by inducing cell cycle arrest and apoptosis[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 702.3±60.0 °C at 760 mmHg |
| Flash Point | 392.5±29.4 °C |
| Exact Mass | 512.277405 |
| PSA | 125.81000 |
| LogP | 2.56 |
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |