Home
Products
2,3,23-Trihydroxy-12-oleanen-28-oic acid
| Product Name | 2,3,23-Trihydroxy-12-oleanen-28-oic acid |
| Price: | Inquiry |
| Catalog No.: | CN08181 |
| CAS No.: | 102519-34-6 |
| Molecular Formula: | C30H48O5 |
| Molecular Weight: | 488.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The leaves and roots of Camptotheca acuminata Decaisne |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@]1(C)[C@H](O)[C@H](O)C[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(CC1)(C)C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoarjunolic acid (2α,3α,23-Trihydroxyolean-12-en-28-oic acid) is a triterpenoid, can be isolated from the stems of Cornus kousa. Isoarjunolic acid could have free radical scavenging activity and elastase inhibition activity [1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 606.0±55.0 °C at 760 mmHg |
| Flash Point | 334.3±28.0 °C |
| Exact Mass | 488.350189 |
| PSA | 97.99000 |
| LogP | 6.51 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |