Home
Products
Shionone
| Product Name | Shionone |
| Price: | $62 / 20mg |
| Catalog No.: | CN08067 |
| CAS No.: | 10376-48-4 |
| Molecular Formula: | C30H50O |
| Molecular Weight: | 426.72 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The flowers of Chrysanthemum morifolium |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC[C@]1(C)CC[C@]2([C@@](C1)(C)CC[C@@]1([C@@H]2CC[C@]2([C@H]1CCC(=O)[C@@H]2C)C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Shionone is the major triterpenoid isolated from Aster tataricus, has anti-tussive, anti-inflammatory activities[1][2]. Shionone possesses a unique six-membered tetracyclic skeleton and 3-oxo-4-monomethyl structure[1]. |
| In Vivo | Shionone (orally administration; 80 mg/kg; 3 days; once daily) shows the trend of enhancing sputum secreting, but has no effect on ammonia-induced cough and reduces xylene-induced ear edema[1]. Animal Model: ICR male mice[1] Dosage: 80 mg/kg Administration: Orally administration; 3 days; once daily Result: Reduced the ear edema for 11.3% by use shionone. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 485.6±14.0 °C at 760 mmHg |
| Flash Point | 200.5±15.1 °C |
| Exact Mass | 426.386169 |
| PSA | 17.07000 |
| LogP | 11.00 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |