Home
Products
Ganoderol B
| Product Name | Ganoderol B |
| Price: | $467 / 5mg |
| Catalog No.: | CN08173 |
| CAS No.: | 104700-96-1 |
| Molecular Formula: | C30H48O2 |
| Molecular Weight: | 440.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruiting body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC/C(=C/CC[C@H]([C@H]1CC[C@@]2([C@]1(C)CC=C1C2=CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderol B is a potent α-glucosidase inhibitor. Ganoderol B has high α-glucosidase inhibition with an IC50 of 48.5 μg/mL (119.8 μM)[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 552.7±50.0 °C at 760 mmHg |
| Flash Point | 226.1±24.7 °C |
| Exact Mass | 440.365417 |
| PSA | 40.46000 |
| LogP | 8.82 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Storage condition | 2-8℃ |