Home
Products
Nomilin
| Product Name | Nomilin |
| Price: | $54 / 20mg |
| Catalog No.: | CN08054 |
| CAS No.: | 1063-77-0 |
| Molecular Formula: | C28H34O9 |
| Molecular Weight: | 514.56 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Citrus reticulata Blanco. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC1CC(=O)OC(C2C1(C)C1CCC3(C4(C1(C(=O)C2)C)OC4C(=O)OC3c1ccoc1)C)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nomilin is a limonoid compound obtained from the extracts of citrus fruits. Nomilin is an anti-obesity and anti-hyperglycemic agent [1][2]. |
| In Vitro | Nomilin treatment significantly mitigated cell death and decreased lactate dehydrogenase (LDH) release and ROS production in SH-SY5Y cells induced by oxygen-glucose deprivation (OGD), which was almost abolished by Nrf2 knockdown[1]. |
| In Vivo | Nomilin attenuated blood-brain barrier (BBB) disruption in MCAO rats, which might be associated with alleviating the loss of tight junction proteins, including ZO-1 and occludin-5[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 657.7±55.0 °C at 760 mmHg |
| Flash Point | 351.6±31.5 °C |
| Exact Mass | 514.220276 |
| PSA | 121.64000 |
| LogP | 2.47 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |