Home
Products
Ganodermanontriol
| Product Name | Ganodermanontriol |
| Price: | $176 / 5mg |
| Catalog No.: | CN08168 |
| CAS No.: | 106518-63-2 |
| Molecular Formula: | C30H48O4 |
| Molecular Weight: | 472.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@]([C@H](CC[C@H]([C@H]1CC[C@@]2([C@]1(C)CC=C1C2=CC[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C)O)(O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganodermanontriol, a sterol isolated from Ganoderma lucidum, induces anti-inflammatory activity in tert-butyl hydroperoxide (t-BHP)-damaged hepatic cells through the expression of HO-1. Ganodermanontriol exhibits hepatoprotective activity[1][2]. |
| In Vitro | Ganodermanontriol inhibits breast cancer cell lines MCF-7 and MDA-MB-231with IC50 values of 5.8 and 9.7 μM, respectively[2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 623.2±55.0 °C at 760 mmHg |
| Flash Point | 344.7±28.0 °C |
| Exact Mass | 472.355255 |
| PSA | 77.76000 |
| LogP | 5.66 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |