Home
Products
Demethylzeylasteral
| Product Name | Demethylzeylasteral |
| Price: | Inquiry |
| Catalog No.: | CN07846 |
| CAS No.: | 107316-88-1 |
| Molecular Formula: | C29H36O6 |
| Molecular Weight: | 480.60 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Tripterygium wilfordii Hook.f. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=Cc1c(O)c(O)cc2c1C(=O)C=C1[C@@]2(C)CC[C@@]2([C@]1(C)CC[C@@]1([C@H]2C[C@](CC1)(C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Demethylzeylasteral is a triterpene compound isolated from Tripterygium wilfordii Hook F, with anti-inflammatory, immunosuppressive and anti-tumor activities[1][2][3][4][5]. Demethylzeylasteral can significantly alleviates atherosclerosis (AS)[5]. Demethylzeylasteral inhibits triple-negative breast cancer invasion by blocking the canonical and non-canonical TGF-β signaling pathways[2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 663.6±55.0 °C at 760 mmHg |
| Flash Point | 369.1±28.0 °C |
| Exact Mass | 480.251190 |
| PSA | 111.90000 |
| LogP | 6.90 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Storage condition | 2-8C |