Home
Products
Bulleyaconitine A
| Product Name | Bulleyaconitine A |
| Price: | Inquiry |
| Catalog No.: | CN02172 |
| CAS No.: | 107668-79-1 |
| Molecular Formula: | C35H49NO10 |
| Molecular Weight: | 643.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum kusnenzoffii Reichb. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@]12CC[C@@H](C34[C@@H]2[C@@H](OC)C(C3N(C1)CC)[C@@]1([C@@H]2[C@H]4C[C@@]([C@@H]2C(=O)c2ccc(cc2)OC)([C@H](C1)OC)O)OC(=O)C)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bulleyaconitine A is an analgesic and antiinflammatory drug isolated from Aconitum plants; has several potential targets, including voltage-gated Na+ channels. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 690.9±55.0 °C at 760 mmHg |
| Flash Point | 371.7±31.5 °C |
| Exact Mass | 627.340759 |
| PSA | 112.99000 |
| LogP | 1.05 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |