Home
Products
Ganoderic acid D
| Product Name | Ganoderic acid D |
| Price: | $380 / 10mg |
| Catalog No.: | CN07796 |
| CAS No.: | 108340-60-9 |
| Molecular Formula: | C30H42O7 |
| Molecular Weight: | 514.66 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(C(=O)O)C)C[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderic acid D, a highly oxygenated tetracyclic triterpenoid, is the major active component of Ganoderma lucidum. Ganoderic acid D upregulates the protein expression of SIRT3 and induces the deacetylated cyclophilin D (CypD) by SIRT3. Ganoderic acid D inhibits the energy reprogramming of colon cancer cells including glucose uptake, lactate production, pyruvate and acetyl-coenzyme production in colon cancer cells[1]. Ganoderic acid D can inhibit the growth of numerous cancer cell lines and it inhibits HeLa human cervical carcinoma cells with an IC50 of 17.3 mM[2]. |
| Target | SIRT3 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 688.3±55.0 °C at 760 mmHg |
| Flash Point | 384.1±28.0 °C |
| Exact Mass | 514.293030 |
| PSA | 125.81000 |
| LogP | 2.43 |
| Vapour Pressure | 0.0±4.9 mmHg at 25°C |