Home
Products
Ganoderenic acid E
| Product Name | Ganoderenic acid E |
| Price: | $380 / 5mg |
| Catalog No.: | CN07304 |
| CAS No.: | 110241-23-1 |
| Molecular Formula: | C30H40O8 |
| Molecular Weight: | 528.63 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(C(=O)O)C)/C=C(C1CC(=O)C2(C1(C)C(O)C(=O)C1=C2C(O)CC2C1(C)CCC(=O)C2(C)C)C)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderenic acid E is a lanostane-type triterpene isolated from Ganoderma lucidum. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 737.1±60.0 °C at 760 mmHg |
| Flash Point | 413.5±29.4 °C |
| Exact Mass | 528.272339 |
| LogP | 1.61 |
| Vapour Pressure | 0.0±5.5 mmHg at 25°C |