Home
Products
Agnuside
| Product Name | Agnuside |
| Price: | $131 / 10mg |
| Catalog No.: | CN03200 |
| CAS No.: | 11027-63-7 |
| Molecular Formula: | C22H26O11 |
| Molecular Weight: | 466.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Vitex negundo L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@@H]3[C@H]2C(=C[C@H]3O)COC(=O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Agnuside is a compound isolated from Vitex negundo, down-regulates pro-inflammatory mediators PGE2 and LTB4, and reduces the expression of cytokines, with anti-arthritic activity[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 785.5±60.0 °C at 760 mmHg |
| Flash Point | 273.5±26.4 °C |
| Exact Mass | 466.147522 |
| PSA | 175.37000 |
| LogP | -1.24 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Storage condition | ?20°C |