Home
Products
Squalene
| Product Name | Squalene |
| Price: | Inquiry |
| Catalog No.: | CN08163 |
| CAS No.: | 111-02-4 |
| Molecular Formula: | C30H50 |
| Molecular Weight: | 410.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Oil |
| Source: | The herbs of Catharanthus roseus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCCC=C(CCC=C(CCC=C(C)C)C)C)CCC=C(CCC=C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Squalene is an intermediate product in the synthesis of cholesterol, and shows several pharmacological properties such as hypolipidemic, hepatoprotective, cardioprotective, antioxidant, and antitoxicant activity. |
| Target | Human Endogenous Metabolite |
| Density | 0.8±0.1 g/cm3 |
| Boiling Point | 429.3±0.0 °C at 760 mmHg |
| Flash Point | 254.1±22.2 °C |
| Exact Mass | 410.391266 |
| LogP | 13.09 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Storage condition | 2-8°C |