Home
Products
20(R)-Ginsenoside Rh2
| Product Name | 20(R)-Ginsenoside Rh2 |
| Price: | $62 / 20mg |
| Catalog No.: | CN07771 |
| CAS No.: | 112246-15-8 |
| Molecular Formula: | C36H62O8 |
| Molecular Weight: | 622.88 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@@H]3[C@@](CCC=C(C)C)(O)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 20(R)-Ginsenoside Rh2, a matrix metalloproteinase (MMP) inhibitor, acts as a cell antiproliferator. It has anticancer effects via blocking cell proliferation and causing G1 phase arrest. 20(R)-Ginsenoside Rh2 induces apoptosis, and has anti-inflammatory and antioxidative activity[1][2][3]. |
| Density | 1.19 |
| Boiling Point | 726.4±60.0 °C at 760 mmHg |
| Flash Point | 393.1±32.9 °C |
| Exact Mass | 622.444458 |
| PSA | 139.84000 |
| LogP | 5.62 |
| Vapour Pressure | 0.0±5.4 mmHg at 25°C |