Home
Products
6-Aldehydoisoophiopogonanone A
| Product Name | 6-Aldehydoisoophiopogonanone A |
| Price: | $351 / 5mg |
| Catalog No.: | CN04881 |
| CAS No.: | 116291-82-8 |
| Molecular Formula: | C19H16O7 |
| Molecular Weight: | 356.33 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Ophiopogon japonicus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=Cc1c(O)c2C(=O)C(COc2c(c1O)C)Cc1ccc2c(c1)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 6-Formyl-isoophiopogonanone A is a homoisoflavonoidal extracted from Ophiopogon japonicas, with antioxidant activity[1]. |
| Density | 1.496±0.06 g/cm3 |
| Boiling Point | 575.3±50.0 °C at 760 mmHg |
| Flash Point | 210.6±23.6 °C |
| Exact Mass | 356.089600 |
| PSA | 102.29000 |
| LogP | 5.68 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |