Home
Products
Loureirin D
| Product Name | Loureirin D |
| Price: | Inquiry |
| Catalog No.: | CN05653 |
| CAS No.: | 119425-91-1 |
| Molecular Formula: | C16H16O5 |
| Molecular Weight: | 288.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The herbs of Dracaena cochinchinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)cc(c1CCC(=O)c1ccc(cc1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Loureirin D is a dihydrochalcone found in dragon’s blood[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 540.9±38.0 °C at 760 mmHg |
| Flash Point | 203.5±20.3 °C |
| Exact Mass | 288.099762 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |