Home
Products
Baohuoside VII
| Product Name | Baohuoside VII |
| Price: | $497 / 5mg |
| Catalog No.: | CN04855 |
| CAS No.: | 119730-89-1 |
| Molecular Formula: | C33H40O15 |
| Molecular Weight: | 676.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Epimedium brevicornum Maxim |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2C(C)OC(C(C2O)O)Oc2c(oc3c(c2=O)c(O)cc(c3CC=C(C)C)O)c2ccc(cc2)OC)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Baohuoside VII is a flavonoid isolated from Herba Epimedii, with anti-osteoporosis activities[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 933.3±65.0 °C at 760 mmHg |
| Flash Point | 295.8±27.8 °C |
| Exact Mass | 676.236694 |
| PSA | 238.20000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |