Home
Products
Escin IA
| Product Name | Escin IA |
| Price: | $92 / 10mg |
| Catalog No.: | CN07509 |
| CAS No.: | 123748-68-5 |
| Molecular Formula: | C55H86O24 |
| Molecular Weight: | 1131.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Aesculus hippocastanum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C(=O)O)O[C@H]2CC[C@]3([C@H]([C@@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)C[C@H]([C@@]2([C@H]3CC(C)(C)[C@H]([C@@H]2OC(=O)C)OC(=O)/C(=C/C)/C)CO)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Escin IA is a triterpene saponin isolated from horse chestnut, which inhibits HIV-1 protease with IC50 values of 35 μM. Escin IA has anti-TNBC metastasis activity, and its action mechanisms involved inhibition of epithelial-mesenchymal transition process by down-regulating LOXL2 expression[1][2]. |
| Density | 1.46 |
| Boiling Point | 1140.6±65.0 °C at 760 mmHg |
| Flash Point | 311.8±27.8 °C |
| Exact Mass | 1130.550903 |
| PSA | 388.04000 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |