Home
Products
Retusin
| Product Name | Retusin |
| Price: | Inquiry |
| Catalog No.: | CN04641 |
| CAS No.: | 1245-15-4 |
| Molecular Formula: | C19H18O7 |
| Molecular Weight: | 358.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Talinum triangulare. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Retusin (Quercetin-3,3',4',7-tetramethylether), a natural compound isolated from the leaves of Talinum triangulare, possesses antiviral and anti-inflammatory activities[1]. |
| Density | 1.36g/cm3 |
| Boiling Point | 569.2ºC at 760mmHg |
| Flash Point | 205.6ºC |
| Exact Mass | 358.10500 |
| PSA | 87.36000 |
| LogP | 3.20000 |
| Vapour Pressure | 1.48E-13mmHg at 25°C |