Home
Products
Quercetin 3,5,7,3,4-pentamethyl ether
| Product Name | Quercetin 3,5,7,3,4-pentamethyl ether |
| Price: | $263 / 10mg |
| Catalog No.: | CN04371 |
| CAS No.: | 1247-97-8 |
| Molecular Formula: | C20H20O7 |
| Molecular Weight: | 372.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Talinum triangulare |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(OC)c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3,5,7,3′,4′-Pentamethoxyflavone is a polymethoxyflavonoid isolated from Kaempferia parviflora. 3,5,7,3′,4′-Pentamethoxyflavone can induce adipogenesis on 3T3-L1 preadipocytes by regulating transcription factors at an early stage of differentiation[1]. |
| Density | 1.29 g/cm3 |
| Boiling Point | 561.9ºC at 760 mmHg |
| Flash Point | 246.9ºC |
| Exact Mass | 372.12100 |
| PSA | 76.36000 |
| LogP | 3.50300 |
| Vapour Pressure | 1.18E-12mmHg at 25°C |