Home
Products
Anemoside B4
| Product Name | Anemoside B4 |
| Price: | $62 / 20mg |
| Catalog No.: | CN08066 |
| CAS No.: | 129741-57-7 |
| Molecular Formula: | C59H96O26 |
| Molecular Weight: | 1221.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herb of Pulsatilla chinensis (Bge.) Regel |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]4[C@@H]4[C@](CC3)(C)[C@]3(C)CC[C@@H]5[C@]([C@H]3CC4)(C)CC[C@@H]([C@@]5(C)CO)O[C@@H]3OC[C@@H]([C@@H]([C@H]3O[C@@H]3O[C@@H](C)[C@@H]([C@H]([C@H]3O)O)O)O)O)C(=C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Anemoside B4 is Pulsatilla koreana Nakai that have many numerous biological effects in vitro, including enhancing hypoglycemic, anti-tumor, neuroprotective and anti-angiogenic activity. AB4 can inhibit the secretion of IL-10; SSA, SSD and PNS up-regulated IL-2 expression.[1] AB4, with IC50 value more than 390 ug/mL. Anemoside B4 inhibits cell proliferation.[2] Anemoside B4 can significantly suppress the secretion of the inflammatory factor E-selectin by endothelial cells. [3] |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1220.619019 |
| PSA | 412.82000 |
| LogP | 4.40 |
| Storage condition | 2~8℃ |