Home
Products
Quinine HCl
| Product Name | Quinine HCl |
| Price: | Inquiry |
| Catalog No.: | CN01715 |
| CAS No.: | 130-89-2 |
| Molecular Formula: | C20H25ClN2O2 |
| Molecular Weight: | 360.88 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The barks of Cinchona ledgeriana (Howard) Moens ex Trim. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](c1ccnc2c1cc(OC)cc2)O.Cl |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.21g/cm3 |
| Boiling Point | 495.9ºC at 760mmHg |
| Flash Point | 253.7ºC |
| Exact Mass | 360.16000 |
| PSA | 45.59000 |
| LogP | 3.91310 |
| Vapour Pressure | 0mmHg at 25°C |