Home
Products
Senecionine N-oxide
| Product Name | Senecionine N-oxide |
| Price: | Inquiry |
| Catalog No.: | CN01466 |
| CAS No.: | 13268-67-2 |
| Molecular Formula: | C18H25NO6 |
| Molecular Weight: | 351.17 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Senecio vulgaris L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC=C1CC(C)C(C)(O)C(=O)OCC2=CC[N+]3(C2C(OC1=O)CC3)[O-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Senecionine n-oxide is the primary product of pyrrolizidine alkaloid biosynthesis in root cultures of Senecio vulgaris. Senecionine N-oxide has anti-cancer activity[1][2]. |
| Exact Mass | 351.16800 |
| PSA | 102.26000 |
| LogP | 1.16420 |