Home
Products
Absinthiin
| Product Name | Absinthiin |
| Price: | Inquiry |
| Catalog No.: | CN07828 |
| CAS No.: | 1362-42-1 |
| Molecular Formula: | C30H40O6 |
| Molecular Weight: | 496.62 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Artemisia absinthium |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1C(=O)OC2C1CCC(C1C2=C(C)C2C1C1C3C2(C(=C1)C)C1OC(=O)C(C1CCC3(C)O)C)(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Absinthin is a structurally unique triterpene, and is responsible for the high bitter value of wormwood. Absinthin is an agonist of the bitter taste receptor hTAS2R46, which reduces cytosolic Ca2+-rises induced by histamine by a receptor-specific mechanism mediated by hTAS2R46[1][2][3]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 700.6±60.0 °C at 760 mmHg |
| Flash Point | 230.8±26.4 °C |
| Exact Mass | 496.282501 |
| PSA | 93.06000 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |