Home
Products
Pomolic acid
| Product Name | Pomolic acid |
| Price: | $293 / 5mg |
| Catalog No.: | CN08125 |
| CAS No.: | 13849-91-7 |
| Molecular Formula: | C30H48O4 |
| Molecular Weight: | 472.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Euscaphis japonica. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC1CCC2(C(C1(C)C)CCC1(C2CC=C2C1(C)CCC1(C2C(C)(O)C(C)CC1)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Randialic acid A (Pomolic acid) is a pentacyclic triterpene isolated from Euscaphis japonica (Tunb.). Randialic acid A (Pomolic acid) inhibits tumor cells growth and induces cell apoptosis. Randialic acid A (Pomolic acid) has a potential for the treatment of prostate cancer (PC)[2]. |
| Target | IC50: apoptosis[1] |
| In Vitro | Randialic acid A (Pomolic acid) induces apoptosis of GBM cells as demonstrated by DNA fragmentation. Pomolic acid-induced apoptosis is dependent on reactive oxygen species (ROS) production. It also induces uncoupling of mitochondria membrane potential and activation of caspase-3 and -9[2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 586.2±50.0 °C at 760 mmHg |
| Flash Point | 322.4±26.6 °C |
| Exact Mass | 472.355255 |
| PSA | 76.66000 |
| LogP | 7.40 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |