Home
Products
Tormentic acid
| Product Name | Tormentic acid |
| Price: | $173 / 5mg |
| Catalog No.: | CN08124 |
| CAS No.: | 13850-16-3 |
| Molecular Formula: | C30H48O5 |
| Molecular Weight: | 488.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Potentilla tormentilla |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1C[C@@]2(C)[C@H](C([C@H]1O)(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2[C@](C)(O)[C@H](C)CC1)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tormentic acid, a triterpene isolated from Rosa rugosa, exerts anti-inflammatory, antihyperlipidemic, and anti-atherogenic properties[1][2]. |
| In Vitro | Tormentic acid inhibits LPS-induced iNOS, COX-2, and TNF-α expression through inactivation of the nuclear factor-κb pathway in RAW 264.7 macrophages[1]. Tormentic acid suppresses high-fat diet-induced diabetes and hyperlipidemia by glucose transporter 4 and AMP-activated protein kinase phosphorylation[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 602.7±55.0 °C at 760 mmHg |
| Flash Point | 332.3±28.0 °C |
| Exact Mass | 488.350189 |
| PSA | 97.99000 |
| LogP | 6.21 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |