Home
Products
Macranthoidin A
| Product Name | Macranthoidin A |
| Price: | $46 / 10mg |
| Catalog No.: | CN07560 |
| CAS No.: | 140360-29-8 |
| Molecular Formula: | C59H96O27 |
| Molecular Weight: | 1237.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Lonicera japonica Thunb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC2OC(OC(=O)C34CCC(CC4C4=CCC5C(C4(CC3)C)(C)CCC3C5(C)CCC(C3(C)CO)OC3OCC(C(C3OC3OC(C)C(C(C3O)OC3OC(CO)C(C(C3O)O)O)O)O)O)(C)C)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Macranthoidin A is an orally active saponin from Flos Lonicerae. Macranthoidin A possess protection effects on hepatic injury caused by Acetaminophen, Cd, and CCl4, and conspicuous depressant effects on swelling of ear croton oil[1]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1236.613892 |
| PSA | 433.05000 |
| LogP | 2.47 |
| Storage condition | -20℃ |