Home
Products
Gamma-Tocotrienol
| Product Name | Gamma-Tocotrienol |
| Price: | Inquiry |
| Catalog No.: | CN03811 |
| CAS No.: | 14101-61-2 |
| Molecular Formula: | C28H42O2 |
| Molecular Weight: | 410.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The stem barks of Garcinia virgata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCCC1(C)CCc2c(O1)c(C)c(c(c2)O)C)CCC=C(CCC=C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | γ-Tocotrienol is an active form of vitamin E[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 530.8±49.0 °C at 760 mmHg |
| Flash Point | 218.4±24.1 °C |
| Exact Mass | 410.318481 |
| PSA | 29.46000 |
| LogP | 10.30 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | −20°C |