Home
Products
Sweroside
| Product Name | Sweroside |
| Price: | $69 / 20mg |
| Catalog No.: | CN03181 |
| CAS No.: | 14215-86-2 |
| Molecular Formula: | C16H22O9 |
| Molecular Weight: | 358.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Swertia bimaculata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C=C[C@H]1[C@@H](OC=C2[C@H]1CCOC2=O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sweroside, isolated from Lonicera japonica, exhibits cytoprotective, anti-osteoporotic, and hepatoprotective effect[1][2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 630.3±55.0 °C at 760 mmHg |
| Flash Point | 231.8±25.0 °C |
| Exact Mass | 358.126373 |
| PSA | 134.91000 |
| LogP | -2.81 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Storage condition | ?20°C |