Home
Products
Hederacoside C
| Product Name | Hederacoside C |
| Price: | $77 / 10mg |
| Catalog No.: | CN07821 |
| CAS No.: | 14216-03-6 |
| Molecular Formula: | C59H96O26 |
| Molecular Weight: | 1221.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The herbs of Hedera nepalensis. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COC1O[CH][C@H]([C@@H]([C@H]1O)O)O[C@H]1[CH][CH][CH][C@@H](O1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hederacoside C is a principal bioactive pharmaceutical ingredient of Hedera helix leaf that can treat respiratory disorders, because of its expectorant, bronchodilator, antibacterial, and bronchospasmolytic effects. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1220.619019 |
| PSA | 412.82000 |
| LogP | 4.52 |
| Storage condition | 2-8°C |