Home
Products
Triptoquinone B
| Product Name | Triptoquinone B |
| Price: | Inquiry |
| Catalog No.: | CN08911 |
| CAS No.: | 142937-50-6 |
| Molecular Formula: | C20H26O4 |
| Molecular Weight: | 330.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The vines of Tripterygium wilfordii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC1(C)C(=O)CCC2(C1CCC1=C2C(=O)C=C(C1=O)C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Triptoquinone B ((+)-Triptoquinone B), a sesquiterpene alkaloid, is an interleukin-1 inhibitor. Triptoquinone B shows potent inhibitory activities against interleukin 1α and β releases for human peripheral mononuclear cells[1][2]. |
| Target | IL-1 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 475.4±45.0 °C at 760 mmHg |
| Flash Point | 255.4±25.2 °C |
| Exact Mass | 330.183105 |
| PSA | 71.44000 |
| LogP | 2.77 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |