Home
Products
Cnidicin
| Product Name | Cnidicin |
| Price: | $728 / 10mg |
| Catalog No.: | CN06057 |
| CAS No.: | 14348-21-1 |
| Molecular Formula: | C21H22O5 |
| Molecular Weight: | 354.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica dahurica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCOc1c2occc2c(c2c1oc(=O)cc2)OCC=C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cnidicin is a coumarin from the root of Angelica koreana, and inhibits the degranulation of mast cell and the nitric oxide (NO) generation in RAW 264.7 cells[1]. |
| In Vitro | Cnidicin shows a significant inhibition upon the release of beta-hexosaminidase from the cultured RBL-2H3 cells in a dose dependent manner (IC50= 25 μM) and upon the nitric oxide production from the activated RAW264.7 cells (IC50=7.5 μM)[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 519.0±50.0 °C at 760 mmHg |
| Flash Point | 267.7±30.1 °C |
| Exact Mass | 354.146729 |
| PSA | 61.81000 |
| LogP | 6.07 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8℃ |