Home
Products
20(R)-Protopanaxatriol
| Product Name | 20(R)-Protopanaxatriol |
| Price: | $100 / 20mg |
| Catalog No.: | CN08024 |
| CAS No.: | 1453-93-6 |
| Molecular Formula: | C30H52O4 |
| Molecular Weight: | 476.73 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC[C@]([C@H]1CC[C@@]2([C@@H]1[C@H](O)C[C@H]1[C@@]2(C)C[C@@H]([C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)O)C)(O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 20(R)-Protopanaxatriol is a natural aglycone of ginsenosides Re, Rf, Rg1, Rg2 and Rh. |
| In Vitro | 20(R)-Protopanaxatriol is a natural aglycone of ginsenosides Re, Rf, Rg1, Rg2 and Rh[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 590.0±50.0 °C at 760 mmHg |
| Flash Point | 240.1±24.7 °C |
| Exact Mass | 476.386566 |
| PSA | 80.92000 |
| LogP | 5.89 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Storage condition | 2-8°C |