Home
Products
Bancroftinone
| Product Name | Bancroftinone |
| Price: | $146 / 10mg |
| Catalog No.: | CN03392 |
| CAS No.: | 14964-98-8 |
| Molecular Formula: | C11H14O4 |
| Molecular Weight: | 210.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The fruits of Syzygium aromaticum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(C)c(OC)cc(c1C(=O)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bancroftinone, a natural product, belongs to the class of alkyl-phenylketones[1]. |
| Exact Mass | 210.08900 |
| PSA | 55.76000 |
| LogP | 1.92040 |
| Storage condition | 2-8℃ |