Home
Products
Kinsenoside
| Product Name | Kinsenoside |
| Price: | $176 / 10mg |
| Catalog No.: | CN06540 |
| CAS No.: | 151870-74-5 |
| Molecular Formula: | C10H16O8 |
| Molecular Weight: | 264.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Anoectochilus roxburghii |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2COC(=O)C2)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kinsenoside is a main active component isolated from plants of the genus Anoectochilus, and exhibits many biological activities and pharmacological effects[1]. Kinsenoside rescues the nucleus pulposus cells (NPCs) viability under oxidative stress and protects against apoptosis, senescence and mitochondrial dysfunction in a Nrf2-dependent way[2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 570.2±50.0 °C at 760 mmHg |
| Flash Point | 226.2±23.6 °C |
| Exact Mass | 264.084503 |
| PSA | 125.68000 |
| LogP | -3.83 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Storage condition | 2-8℃ |