Home
Products
3,5-Dihydroxy-4',7-dimethoxyflavone
| Product Name | 3,5-Dihydroxy-4',7-dimethoxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN05503 |
| CAS No.: | 15486-33-6 |
| Molecular Formula: | C17H14O6 |
| Molecular Weight: | 314.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Andrographis paniculata (Burm. f.) Nees |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1oc2cc(OC)cc(c2c(=O)c1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaempferol-7,4'-dimethyl ether is found in Boesenbergia longiflora[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 539.4±50.0 °C at 760 mmHg |
| Flash Point | 201.7±23.6 °C |
| Exact Mass | 314.079041 |
| PSA | 89.13000 |
| LogP | 3.25 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |