Home
Products
Kaempferol 3,7,4'-trimethylether
| Product Name | Kaempferol 3,7,4'-trimethylether |
| Price: | Inquiry |
| Catalog No.: | CN04847 |
| CAS No.: | 15486-34-7 |
| Molecular Formula: | C18H16O6 |
| Molecular Weight: | 328.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Curcuma aromatica. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1oc2cc(OC)cc(c2c(=O)c1OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaempferol 3,7,4'-trimethyl ether is a flavonol aglycone isolated from the leaves of Siparuna gigantotepala, has antioxidant activity[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 549.0±50.0 °C at 760 mmHg |
| Flash Point | 202.2±23.6 °C |
| Exact Mass | 328.094696 |
| PSA | 78.13000 |
| LogP | 2.97 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8°C |