Home
Products
Lupenone
| Product Name | Lupenone |
| Price: | $131 / 10mg |
| Catalog No.: | CN08076 |
| CAS No.: | 1617-70-5 |
| Molecular Formula: | C30H48O |
| Molecular Weight: | 424.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The roots of Pueraria thomsonii Benth. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CCC(=O)C1(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lupenone, isolated from Rhizoma Musae, belongs to lupane type triterpenoids. Lupenone shows various pharmacological activities including anti-inflammatory, anti-virus, anti-diabetes, anti-cancer, improving Chagas disease without major toxicity[1][2]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 487.9±12.0 °C at 760 mmHg |
| Flash Point | 278.4±5.7 °C |
| Exact Mass | 424.370514 |
| PSA | 17.07000 |
| LogP | 10.39 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |