Home
Products
trans-4-(Trifluoromethyl)cinnamic acid
| Product Name | trans-4-(Trifluoromethyl)cinnamic acid |
| Price: | Inquiry |
| Catalog No.: | CN06976 |
| CAS No.: | 16642-92-5 |
| Molecular Formula: | C10H7F3O2 |
| Molecular Weight: | 216.16 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | White cryst. |
| Source: | The barks of Cinnamomum cassia Presl |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)/C=C/c1ccc(cc1)C(F)(F)F |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 279.2±35.0 °C at 760 mmHg |
| Flash Point | 122.6±25.9 °C |
| Exact Mass | 216.039810 |
| PSA | 37.30000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |