Home
Products
Epifriedelanol
| Product Name | Epifriedelanol |
| Price: | $77 / 10mg |
| Catalog No.: | CN08071 |
| CAS No.: | 16844-71-6 |
| Molecular Formula: | C30H52O |
| Molecular Weight: | 428.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Vitis trifolia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC1CCC2C(C1C)(C)CCC1C2(C)CCC2(C1(C)CCC1(C2CC(C)(C)CC1)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Epifriedelanol is a triterpenoid isolated from the root bark of Ulmus davidiana, with antitumor activity[1]. Epifriedelanol inhibits cellular senescence in human primary cells[2]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 478.3±13.0 °C at 760 mmHg |
| Flash Point | 199.6±12.3 °C |
| Exact Mass | 428.401825 |
| PSA | 20.23000 |
| LogP | 11.45 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Storage condition | 2-8C |