Home
Products
11-Keto-beta-boswellic acid
| Product Name | 11-Keto-beta-boswellic acid |
| Price: | $249 / 20mg |
| Catalog No.: | CN07845 |
| CAS No.: | 17019-92-0 |
| Molecular Formula: | C30H46O4 |
| Molecular Weight: | 470.68 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The herbs of Boswellia carterii Birdw. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@]2(C([C@H]1C)C1=CC(=O)C3[C@@]([C@@]1(CC2)C)(C)CCC1[C@]3(C)CC[C@H]([C@]1(C)C(=O)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 11-Keto-beta-boswellic acid (11-Keto-β-boswellic acid) is a pentacyclic triterpenic acid of the oleogum resin from the bark of the Boswellia serrate tree, popularly known as Indian Frankincense. 11-Keto-beta-boswellic acid has the anti-inflammatory activity is primarily due to inhibit 5-lipoxygenase and subsequent leukotriene and nuclear factor-kappa B (NF-κB) activation and tumor necrosis factor alpha generation production[1]. |
| Target | NF-κB |
| Density | 1.14g/cm3 |
| Boiling Point | 591.8ºC at 760mmHg |
| Flash Point | 325.8ºC |
| Exact Mass | 470.34000 |
| PSA | 74.60000 |
| LogP | 6.26850 |
| Vapour Pressure | 0mmHg at 25°C |
| Storage condition | 2-8C |