Home
Products
Isosinensetin
| Product Name | Isosinensetin |
| Price: | $146 / 20mg |
| Catalog No.: | CN04820 |
| CAS No.: | 17290-70-9 |
| Molecular Formula: | C20H20O7 |
| Molecular Weight: | 372.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Citrus aurantium L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1OC)c1cc(=O)c2c(o1)c(OC)c(cc2OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isosinensetin, a polymethoxylated flavone extracted from pericarpium citri reticulatae viride, exhibits inhibition on P-glycoprotein (P-gp) in MDR1-MDCKII cells[1][2]. |
| Target | P-glycoprotein[2] |
| Density | 1.244±0.06 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 565.3±50.0 °C at 760 mmHg |
| Flash Point | 248.4±30.2 °C |
| Exact Mass | 372.120911 |
| PSA | 76.36000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |