Home
Products
Ganoderic acid DM
| Product Name | Ganoderic acid DM |
| Price: | Inquiry |
| Catalog No.: | CN08068 |
| CAS No.: | 173075-45-1 |
| Molecular Formula: | C30H44O4 |
| Molecular Weight: | 468.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucida |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]([C@H]1CC[C@@]2([C@]1(C)CCC1=C2C(=O)C[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)CC/C=C(/C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderic acid DM, a natural triterpenoid isolated from Ganoderma lucidum, induces DNA damage, G1 cell cycle arrest and apoptosis in human breast cancer cells. Ganoderic acid DM as a specific inhibitor of osteoclastogenesis[1][2]. |
| In Vitro | Ganoderic acid DM (GADM) effectively inhibits cell proliferation and colony formation in MCF-7 human breast cancer cells, which was much stronger than that of MDA-MB-231 breast cancer cells[1]. Ganoderic acid DM especially suppresses the expression of c-Fos and nuclear factor of activated T cells c1 (NFATc1). Ganoderic acid DM markedly suppressed the expression of cathepsin K and TRAP mRNA[2]. Ganoderic acid DM induces autophagic apoptosis in non-small cell lung cancer cells by inhibiting the PI3K/Akt/mTOR activity[3]. Cell Viability Assay[1] Cell Line: MCF-7 and MDA-MB-231 cells. Concentration: 0-100 μM. Incubation Time: 48 h. Result: Decreased the cell viability in breast cancer cells. Cell Viability Assay[2] Cell Line: RAW-D cells. Concentration: 0-100 μg/mL. Incubation Time: 0-100 μg/mL. Result: Clearly suppressed osteoclastogenesis from the RAW 264 cell D-clone. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 602.1±55.0 °C at 760 mmHg |
| Flash Point | 332.0±28.0 °C |
| Exact Mass | 468.323975 |
| PSA | 71.44000 |
| LogP | 6.90 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |