Home
Products
Apigenin 7-O-(2G-rhamnosyl)gentiobioside
| Product Name | Apigenin 7-O-(2G-rhamnosyl)gentiobioside |
| Price: | $263 / 10mg |
| Catalog No.: | CN04897 |
| CAS No.: | 174284-20-9 |
| Molecular Formula: | C33H40O19 |
| Molecular Weight: | 740.67 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Lonicera japonica Thunb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC2OC(Oc3cc(O)c4c(c3)oc(cc4=O)c3ccc(cc3)O)C(C(C2O)O)OC2OC(C)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Apigenin-7-O-(2G-rhamnosyl)gentiobioside is a flavone glycosides from Lonicera gracilipes var. glandulosa[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 1071.5±65.0 °C at 760 mmHg |
| Flash Point | 337.9±27.8 °C |
| Exact Mass | 740.216370 |
| LogP | -0.75 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |