Home
Products
Flavokawain B
| Product Name | Flavokawain B |
| Price: | $176 / 10mg |
| Catalog No.: | CN05654 |
| CAS No.: | 1775-97-9 |
| Molecular Formula: | C17H16O4 |
| Molecular Weight: | 284.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Piper methysticum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c(c(c1)OC)C(=O)/C=C/c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Flavokawain B (Flavokavain B) is a chalcone isolated from the root extracts of kava-kava plant and a potent apoptosis inducer for inhibiting the growth of various cancer cell lines. Flavokawain B (Flavokavain B) shows strong antiangiogenic activity. Flavokawain B (Flavokavain B) inhibits human brain endothelial cell (HUVEC) migration and tube formation with very low and non-toxic concentrations[1][2]. |
| Density | 1.203±0.06 g/cm3 |
| Boiling Point | 500.1±50.0 °C at 760 mmHg |
| Flash Point | 185.8±23.6 °C |
| Exact Mass | 284.104858 |
| PSA | 55.76000 |
| LogP | 4.01 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | -20℃ |