Home
Products
Sauchinone
| Product Name | Sauchinone |
| Price: | $103 / 20mg |
| Catalog No.: | CN08741 |
| CAS No.: | 177931-17-8 |
| Molecular Formula: | C20H20O6 |
| Molecular Weight: | 356.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Saururus chinensis(Lour.) Baill. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1C[C@H]2C(=O)C=C3[C@]4([C@@H]2[C@@H]([C@H]1C)c1cc2OCOc2cc1O4)OCO3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sauchinone is a diastereomeric lignan isolated from Saururus chinensis (Saururaceae). Sauchinone inhibits LPS-inducible iNOS, TNF-α and COX-2 expression through suppression of I-κBα phosphorylation and p65 nuclear translocation. Sauchinone has anti-inflammatory and antioxidant activity[1]. |
| Target | p65 I-kappaBalpha |
| In Vitro | Sauchinone (1, 3, 10, 30μm; 6 hours) inhibits LPS-inducible increase in the iNOS mRNA in Raw264.7 cells[1]. Sauchinone at the concentrations of 3 and 30 μm inhibits TNF-α production in LPS-treated cells by 40 and 50%, respectively[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 498.1±45.0 °C at 760 mmHg |
| Flash Point | 220.3±28.8 °C |
| Exact Mass | 356.125977 |
| PSA | 63.22000 |
| LogP | 3.81 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8°C |