Home
Products
Phytolaccagenin
| Product Name | Phytolaccagenin |
| Price: | Inquiry |
| Catalog No.: | CN08063 |
| CAS No.: | 1802-12-6 |
| Molecular Formula: | C31H48O7 |
| Molecular Weight: | 532.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Phytolacca acinosa Roxb |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)[C@]1(C)CC[C@]2([C@H](C1)C1=CC[C@H]3[C@@]([C@@]1(CC2)C)(C)CCC1[C@]3(C)C[C@H](O)[C@@H]([C@@]1(C)CO)O)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Phytolaccagenin, a triterpenoid saponin, is the active component of Radix Phytolaccae. Phytolcaccagenin has antifungal activity, anti-inflammatory activity and lower toxicity[1] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 639.6±55.0 °C at 760 mmHg |
| Flash Point | 199.3±25.0 °C |
| Exact Mass | 532.340027 |
| PSA | 124.29000 |
| LogP | 5.24 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |