Home
Products
Fabiatrin
| Product Name | Fabiatrin |
| Price: | $377 / 5mg |
| Catalog No.: | CN06142 |
| CAS No.: | 18309-73-4 |
| Molecular Formula: | C21H26O13 |
| Molecular Weight: | 486.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Thalictrum fortunei |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc2ccc(=O)oc2cc1OC1OC(COC2OCC(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Fabiatrin is a natural product isolated from Przewalskia tangutica[1]. |
| Density | 1.65±0.1 g/cm3(Predicted) |
| Boiling Point | 801.8±65.0 °C(Predicted) |
| Exact Mass | 486.13700 |
| PSA | 197.74000 |