Home
Products
Madecassic acid
| Product Name | Madecassic acid |
| Price: | $46 / 20mg |
| Catalog No.: | CN08058 |
| CAS No.: | 18449-41-7 |
| Molecular Formula: | C30H48O6 |
| Molecular Weight: | 504.70 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Centella asiatica (L.) Urban |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC1(C)C(O)C(O)CC2(C1C(O)CC1(C2CC=C2C1(C)CCC1(C2C(C)C(CC1)C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Madecassic acid is isolated from Centella asiatica (Umbelliferae). Madecassic acid has anti-inflammatory properties caused by iNOS, COX-2, TNF-alpha, IL-1beta, and IL-6 inhibition via the downregulation of NF-κB activation in RAW 264.7 macrophage cells[1]. |
| Target | COX-2 TNF-α IL-1β IL-6 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 641.7±55.0 °C at 760 mmHg |
| Flash Point | 355.9±28.0 °C |
| Exact Mass | 504.345093 |
| PSA | 118.22000 |
| LogP | 4.99 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Storage condition | 2-8°C |