Home
Products
Alisol A 24-acetate
| Product Name | Alisol A 24-acetate |
| Price: | $161 / 20mg |
| Catalog No.: | CN07816 |
| CAS No.: | 18674-16-3 |
| Molecular Formula: | C32H52O6 |
| Molecular Weight: | 532.75 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The tubers of Alisma plantago-aquatica Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@H](C(O)(C)C)[C@H](C[C@H](C1=C2C[C@H](O)[C@@H]3[C@]([C@]2(CC1)C)(C)CC[C@@H]1[C@]3(C)CCC(=O)C1(C)C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Alisol A 24-acetate is a natural product. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 641.1±55.0 °C at 760 mmHg |
| Flash Point | 196.5±25.0 °C |
| Exact Mass | 532.376404 |
| PSA | 104.06000 |
| LogP | 5.27 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Storage condition | -20°C |